Home
Products
Didymin
| Product Name | Didymin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05053 |
| CAS No.: | 14259-47-3 |
| Molecular Formula: | C28H34O14 |
| Molecular Weight: | 594.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Clinopodium chinense |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)cc(cc2O)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Didymin, a dietary flavonoid glycoside from citrus fruits, possesses antioxidant properties. Didymin induces apoptosis by inhibiting N-Myc and upregulating RKIP in neuroblastoma[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 896.6±65.0 °C at 760 mmHg |
| Flash Point | 295.3±27.8 °C |
| Exact Mass | 594.194885 |
| PSA | 214.06000 |
| LogP | 2.72 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20℃ |