Home
Products
Narirutin
| Product Name | Narirutin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05532 |
| CAS No.: | 14259-46-2 |
| Molecular Formula: | C27H32O14 |
| Molecular Weight: | 580.53 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The young fruits of Citrus grandis (L.) Osbeck. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc(cc1)[C@@H]1CC(=O)c2c(O1)cc(cc2O)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Narirutin, one of the active constituents isolated from Citrus unshiu, has antioxidant and anti-inflammatory activities. Narirutin is a shikimate kinase inhibitor with anti-tubercular potency[1][2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 924.3±65.0 °C at 760 mmHg |
| Flash Point | 307.3±27.8 °C |
| Exact Mass | 580.179199 |
| PSA | 225.06000 |
| LogP | 2.07 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |