Home
Products
Asperuloside
| Product Name | Asperuloside |
| Price: | $69 / 20mg |
| Catalog No.: | CN03180 |
| CAS No.: | 14259-45-1 |
| Molecular Formula: | C18H22O11 |
| Molecular Weight: | 414.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Galium aparine L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C3[C@@H]4[C@H]2C(=C[C@@H]4OC3=O)COC(=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Asperuloside is an iridoid isolated from Hedyotis diffusa, with anti-inflammatory activity. Asperuloside inhibits inducible nitric oxide synthase (iNOS), suppresses NF-κB and MAPK signaling pathways[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 704.2±60.0 °C at 760 mmHg |
| Flash Point | 254.1±26.4 °C |
| Exact Mass | 414.116211 |
| PSA | 161.21000 |
| LogP | -3.28 |
| Vapour Pressure | 0.0±5.1 mmHg at 25°C |
| Storage condition | 2-8C |