Home
Products
9-Dihydro-13-acetylbaccatin III
| Product Name | 9-Dihydro-13-acetylbaccatin III |
| Price: | $62 / 10mg |
| Catalog No.: | CN08366 |
| CAS No.: | 142203-65-4 |
| Molecular Formula: | C33H42O12 |
| Molecular Weight: | 630.68 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Taxus canadensis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1C[C@@]2(O)[C@@H](OC(=O)c3ccccc3)[C@@H]3[C@@]4(CO[C@@H]4C[C@@H]([C@]3([C@H]([C@@H](C(=C1C)C2(C)C)OC(=O)C)O)C)O)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 9-Dihydro-13-acetylbaccatin III (9-DHAB III) is an intermediate for taxol analog preparations. IC50 value:Target: There are a series of closely related natural organic compounds isolated from the Pacific yew tree (Taxus brevifolia) and related species. Taxols have exhibit antitumor agents. 9-Dihydro-13-acetylbaccatin III is an antineoplastic agent and an anti-cancer intermediate. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 601.4±55.0 °C at 760 mmHg |
| Flash Point | 193.0±25.0 °C |
| PSA | 148.82000 |
| LogP | 0.69 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Storage condition | 2-8°C |