Home
Products
Beta-D-glucopyranosyl oleanolate
| Product Name | Beta-D-glucopyranosyl oleanolate |
| Price: | $366 / 10mg |
| Catalog No.: | CN07490 |
| CAS No.: | 14162-53-9 |
| Molecular Formula: | C36H58O8 |
| Molecular Weight: | 618.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Hedera nepalensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)[C@@]23CCC(C[C@H]3C3=CC[C@H]4[C@@]([C@@]3(CC2)C)(C)CC[C@@H]2[C@]4(C)CC[C@@H](C2(C)C)O)(C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oleanolic acid 28-O-β-D-glucopyranoside (β-D-Glucopyranosyl oleanolate) is a saponin isolated from the roots of Achyranthes bidentata Blume[1]. |
| Density | 1.23±0.1 g/cm3 at 760 mmHg |
| Boiling Point | 696.7±55.0 °C at 760 mmHg |
| Exact Mass | 618.41300 |
| PSA | 136.68000 |
| LogP | 4.49210 |
| Storage condition | 2-8°C |