Home
Products
Polyporusterone B
| Product Name | Polyporusterone B |
| Price: | $161 / 5mg |
| Catalog No.: | CN02264 |
| CAS No.: | 141360-89-6 |
| Molecular Formula: | C28H44O6 |
| Molecular Weight: | 476.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Polyporus umbellatus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C(=C)C[C@H]([C@@]([C@H]1CC[C@@]2([C@]1(C)CC[C@H]1C2=CC(=O)[C@H]2[C@]1(C)C[C@H](O)[C@@H](C2)O)O)(O)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Polyporusterone B is a triterpene carboxylic acid isolated from Polyporus umbellatus Fries. Polyporusterone B has inhibitory effect on free radical-induced lysis of red blood cells[1]. |
| Exact Mass | 476.31400 |
| PSA | 118.22000 |
| LogP | 2.90520 |
| Storage condition | 2-8℃ |