Home
Products
Nerylacetate
| Product Name | Nerylacetate |
| Price: | Inquiry |
| Catalog No.: | CN09636 |
| CAS No.: | 141-12-8 |
| Molecular Formula: | C12H20O2 |
| Molecular Weight: | 196.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | Found in citrus, kumquat and pummelo peel oils, ginger, cardamon, clary sage and myrtle. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=C/COC(=O)C)/CCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neryl acetate is a chemical compound isolated from citrus oils[1]. |
| Density | 0.91 |
| Boiling Point | 134ºC |
| Flash Point | 210 °F |
| Exact Mass | 196.14600 |
| PSA | 26.30000 |
| LogP | 3.24220 |
| Vapour Pressure | 9.07E-05mmHg at 25°C |
| Storage condition | 2-8°C |