Home
Products
(-)-Menthone
| Product Name | (-)-Menthone |
| Price: | $62 / 50mg |
| Catalog No.: | CN09607 |
| CAS No.: | 14073-97-3 |
| Molecular Formula: | C10H18O |
| Molecular Weight: | 154.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The essential oils of Mentha |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@H](C(=O)C1)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Menthone is a monoterpene component of the essential oil of maturing peppermint. (+)-Neomenthyl-β-d-glucoside is a metabolite of (-)-Menthone[1]. |
| Density | 0.89 |
| Boiling Point | 207-210ºC |
| Flash Point | 72ºC |
| Exact Mass | 154.13600 |
| PSA | 17.07000 |
| LogP | 2.64770 |
| Vapour Pressure | 0.256mmHg at 25°C |
| Storage condition | 2-8°C |