Home
Products
Heteroclitin D
| Product Name | Heteroclitin D |
| Price: | $161 / 10mg |
| Catalog No.: | CN02690 |
| CAS No.: | 140369-76-2 |
| Molecular Formula: | C27H30O8 |
| Molecular Weight: | 482.19 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The stems of Kadsura heteroclita |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(/C(=O)OC1C(C)C(C)CC2=CC(=C(C(=O)C32c2c1cc1OCOc1c2OC3)OC)OC)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Heteroclitin D is a lignin from Kadsura medicinal plants with anti-liqid peroxidation. Heteroclitin D inhibits L-type calcium channels[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 640.3±55.0 °C at 760 mmHg |
| Flash Point | 273.3±31.5 °C |
| Exact Mass | 482.194061 |
| PSA | 89.52000 |
| LogP | 5.66 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |