Home
Products
Epimedin A1
| Product Name | Epimedin A1 |
| Price: | $190 / 10mg |
| Catalog No.: | CN05545 |
| CAS No.: | 140147-77-9 |
| Molecular Formula: | C39H50O20 |
| Molecular Weight: | 838.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | White powder |
| Source: | The herb of Epimedium brevicornum Maxim. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(cc1)c1oc2c(CC=C(C)C)c(O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)cc(c2c(=O)c1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epimedin A1 is a flavonoid extracted from Herba Epimedii which is one of commonly used Chinese medicines. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1112.3±65.0 °C at 760 mmHg |
| Flash Point | 337.1±27.8 °C |
| Exact Mass | 838.289551 |
| PSA | 317.35000 |
| LogP | -0.21 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |