Home
Products
3,6'-Disinapoyl sucrose
| Product Name | 3,6'-Disinapoyl sucrose |
| Price: | $46 / 20mg |
| Catalog No.: | CN06877 |
| CAS No.: | 139891-98-8 |
| Molecular Formula: | C34H42O19 |
| Molecular Weight: | 754.68 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(C=CC(=O)OCC2OC(OC3(CO)OC(C(C3OC(=O)C=Cc3cc(OC)c(c(c3)OC)O)O)CO)C(C(C2O)O)O)cc(c1O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3',6-Disinapoylsucrose, the index component of Yuanzhi (Polygala tenuifolia Willd), possesses potent antioxidant activity and antidepressant effect[1][2]. |
| Density | 1.56±0.1 g/cm3 |
| Boiling Point | 988.0±65.0 °C at 760 mmHg |
| Flash Point | 306.6±27.8 °C |
| Exact Mass | 754.232056 |
| PSA | 279.05000 |
| LogP | 2.40 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8C |