Home
Products
Tenuifoliside C
| Product Name | Tenuifoliside C |
| Price: | $290 / 10mg |
| Catalog No.: | CN06802 |
| CAS No.: | 139726-37-7 |
| Molecular Formula: | C35H44O19 |
| Molecular Weight: | 768.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C1O)OC(=O)C=Cc1cc(OC)c(c(c1)OC)OC)(CO)OC1OC(COC(=O)C=Cc2cc(OC)c(c(c2)OC)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tenuifoliside C, isolated from polygala tenuifolia willd, significantly inhibits chlorzoxazone 6-hydroxylation catalyzed by CYP2E1[1]. |
| Exact Mass | 768.24800 |
| PSA | 268.05000 |
| Storage condition | 2-8℃ |