Home
Products
Tenuifoliside B
| Product Name | Tenuifoliside B |
| Price: | $293 / 10mg |
| Catalog No.: | CN06803 |
| CAS No.: | 139726-36-6 |
| Molecular Formula: | C30H36O17 |
| Molecular Weight: | 668.60 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@]([C@H]([C@@H]1O)OC(=O)/C=C/c1cc(OC)c(c(c1)OC)O)(CO)O[C@H]1O[C@H](COC(=O)c2ccc(cc2)O)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tenuifoliside B, a component isolated from Polygalae Radix, inhibits potassium cyanide (KCN)-induced hypoxia and scopolamine-induced memory impairment. Tenuifoliside B shows potential cognitive improvement and cerebral protective effects. Tenuifoliside B has potential to become an anti-AD lead compound[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 926.1±65.0 °C at 760 mmHg |
| Flash Point | 296.8±27.8 °C |
| Exact Mass | 668.195251 |
| LogP | 3.19 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |