Home
Products
Tripterifordin
| Product Name | Tripterifordin |
| Price: | $263 / 10mg |
| Catalog No.: | CN08919 |
| CAS No.: | 139122-81-9 |
| Molecular Formula: | C20H30O3 |
| Molecular Weight: | 318.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Tripterygium wilfordii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1OCC23C(C1(C)CCC2)CCC12C3CCC(C1)C(C2)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tripterifordin, isolated from the roots of Tripterygium wilfordii, possesses significant anti-HIV replication activities in H9 lymphocyte cells with an EC50 value of 3100 nM, respectively[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 485.1±45.0 °C at 760 mmHg |
| Flash Point | 198.6±21.5 °C |
| Exact Mass | 318.219482 |
| PSA | 46.53000 |
| LogP | 3.20 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |