Home
Products
(-)-Heraclenol
| Product Name | (-)-Heraclenol |
| Price: | $380 / 10mg |
| Catalog No.: | CN06086 |
| CAS No.: | 139079-42-8 |
| Molecular Formula: | C16H16O6 |
| Molecular Weight: | 304.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The aerial parts of Incarvillea younghusbandii. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)c(OCC(C(O)(C)C)O)c1c(c2)cco1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Heraclenol is a derivative of furocoumarin isolated from Ducrosia anethifolia. (-)-Heraclenol shows antiproliferative and cytotoxic activities on cancer cell lines[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 544.3±50.0 °C at 760 mmHg |
| Flash Point | 283.0±30.1 °C |
| Exact Mass | 304.094696 |
| PSA | 93.04000 |
| LogP | 1.24 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |