Home
Products
Anemarsaponin B
| Product Name | Anemarsaponin B |
| Price: | Inquiry |
| Catalog No.: | CN02587 |
| CAS No.: | 139051-27-7 |
| Molecular Formula: | C45H74O18 |
| Molecular Weight: | 903.04 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Anemarrhena asphodeloides Bunge. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CCC3(C(C2)CCC2C3CCC3(C2CC2C3C(=C(O2)CCC(COC2OC(CO)C(C(C2O)O)O)C)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Anemarsaponin B is a steroidal saponin isolated from the rhizomes of A. asphodeloides (Liliaceae). Anemarsaponin B decreases the protein and mRNA levels of iNOS and COX-2. Anemarsaponin B reduces the expressions and productions of pro-inflammatory cytokines, including TNF-a and IL-6. Anemarsaponin B inhibits the nuclear translocation of the p65 subunit of NF-κB by blocking the phosphorylation of IκBα. Anemarsaponin B also inhibits the phosphorylation of MAP kinase kinases 3/6 (MKK3/6) and mixed lineage kinase 3 (MLK3). Anti-inflammatory effect [1]. |
| Target | COX-2 p65 iNOS |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1023.7±65.0 °C at 760 mmHg |
| Flash Point | 572.9±34.3 °C |
| Exact Mass | 902.487488 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |