Home
Products
Eugenol rutinoside
| Product Name | Eugenol rutinoside |
| Price: | $701 / 5mg |
| Catalog No.: | CN07031 |
| CAS No.: | 138772-01-7 |
| Molecular Formula: | C22H32O11 |
| Molecular Weight: | 472.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Leonurus artemisia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | C=CCc1ccc(c(c1)OC)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eugenol rutinoside is found in dendropanax dentiger[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 690.7±55.0 °C at 760 mmHg |
| Flash Point | 371.5±31.5 °C |
| Exact Mass | 472.194458 |
| PSA | 167.53000 |
| LogP | 1.67 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |