Home
Products
Agomelatine
| Product Name | Agomelatine |
| Price: | Inquiry |
| Catalog No.: | CN02015 |
| CAS No.: | 138112-76-2 |
| Molecular Formula: | C15H17NO2 |
| Molecular Weight: | 243.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Agomelatine is a competitive antagonist of human and porcine serotonin (5-HT2C) receptors (pKi = 6.2 and 6.4, respectively) as well as human 5-HT2B receptors (pKi = 6.6). IC50 value: 6.2 (pKi, 5-HT2c); 6.6 (pKi, 5-HT2b)Target: 5-HT2C Receptor; 5-HT2B receptorIt is classified as a norepinephrine-dopamine disinhibitor (NDDI) due to its antagonism of the 5-HT2C receptor. Activation of 5-HT2C receptors by serotonin inhibits dopamine and norepinephrine release. Antagonism of 5-HT2C results in an enhancement of DA and NE release and activity of frontocortical dopaminergic and adrenergic pathways. Agomelatine is also a potent agonist at melatonin receptors which makes it the first melatonergic antidepressant. Agomelatine is an antidepressant drug. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 478.8±28.0 °C at 760 mmHg |
| Flash Point | 243.4±24.0 °C |
| Exact Mass | 243.125931 |
| PSA | 38.33000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | -20°C Freezer |