Home
Products
Shikimic acid
| Product Name | Shikimic acid |
| Price: | $12 / 20mg |
| Catalog No.: | CN06733 |
| CAS No.: | 138-59-0 |
| Molecular Formula: | C7H10O5 |
| Molecular Weight: | 174.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Illicium verum. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1CC(=C[C@H]([C@H]1O)O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Shikimic acid is a key metabolic intermediate of the aromatic amino acid biosynthesis pathway, found in microbes and plants. |
| Target | Human Endogenous Metabolite |
| In Vitro | Shikimic acid is an important metabolic intermediate with various applications. Shikimic acid is an industrially important compound that acts as a precursor in the synthesis of many chemical substances like oseltamivir phosphate[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 400.5±45.0 °C at 760 mmHg |
| Flash Point | 210.1±25.2 °C |
| Exact Mass | 174.052826 |
| PSA | 97.99000 |
| LogP | -0.92 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |