Home
Products
Poricoic acid A(F)
| Product Name | Poricoic acid A(F) |
| Price: | $77 / 10mg |
| Catalog No.: | CN07593 |
| CAS No.: | 137551-38-3 |
| Molecular Formula: | C31H46O5 |
| Molecular Weight: | 498.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Wolfiporia cocos (Schw.) Ryv. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC(=O)CC[C@@]1(C)[C@@H](CC=C2C1=CC[C@]1([C@@]2(C)C[C@H]([C@@H]1[C@H](C(=O)O)CCC(=C)C(C)C)O)C)C(=C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Poricoic acid A, isolated from Poria cocos, possesses anti-tumor activity[1]. Poricoic acid A enhances melatonin inhibition of AKI-to-CKD transition by regulating Gas6/AxlNFκB/Nrf2 axis[2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 664.0±55.0 °C at 760 mmHg |
| Flash Point | 369.3±28.0 °C |
| Exact Mass | 498.334534 |
| PSA | 94.83000 |
| LogP | 7.26 |
| Vapour Pressure | 0.0±4.6 mmHg at 25°C |