Home
Products
Dehydroeffusol
| Product Name | Dehydroeffusol |
| Price: | $263 / 5mg |
| Catalog No.: | CN03719 |
| CAS No.: | 137319-34-7 |
| Molecular Formula: | C17H14O2 |
| Molecular Weight: | 250.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The stems of Juncus effusus L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=Cc1cc(O)cc2c1c1ccc(c(c1cc2)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydroeffusol is a phenanthrene from medicinal herb Juncus effuses. Dehydroeffusol inhibits gastric cancer cell growth and tumorigenicity by selectively inducing tumor-suppressive endoplasmic reticulum stress and a moderate apoptosis. It shows very low toxicity[1][2]. |
| In Vitro | Dehydroeffusol suppresses the expression of vasculogenic mimicry key gene VE-cadherin[2]. Dehydroeffusol decreases the MMP2 expression and activity in gastric cancer cells[2]. |
| Exact Mass | 250.09900 |
| PSA | 40.46000 |
| LogP | 4.35560 |