Home
Products
Voriconazole
| Product Name | Voriconazole |
| Price: | Inquiry |
| Catalog No.: | CN00154 |
| CAS No.: | 137234-62-9 |
| Molecular Formula: | C16H14F3N5O |
| Molecular Weight: | 349.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Fc1ccc(c(c1)F)[C@]([C@H](c1ncncc1F)C)(Cn1cncn1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Voriconazole(UK-109496) is a second-generation triazole antifungal used to treat serious fungal infections.IC50 Value: Target: AntifungalVoriconazole displays potent activity against Candida, Cryptococcus and Aspergillus species. Voriconazole inhibits ergosterol synthesis by inhibiting CYP450-dependent 14-α sterol demethylase resulting in a depletion of ergosterol in fungal cell membranes. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 508.6±60.0 °C at 760 mmHg |
| Flash Point | 261.4±32.9 °C |
| PSA | 76.72000 |
| LogP | 0.93 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | Store at +4°C |