Home
Products
Calcium pantothenate
| Product Name | Calcium pantothenate |
| Price: | $15 / 20mg |
| Catalog No.: | CN00070 |
| CAS No.: | 137-08-6 |
| Molecular Formula: | C18H32CaN2O10 |
| Molecular Weight: | 476.54 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC([C@H](C(=O)NCCC(=O)[O-])O)(C)C.OCC([C@H](C(=O)NCCC(=O)[O-])O)(C)C.[Ca+2] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | D-Pantothenic acid hemicalcium salt, a kind of water solublevitamin, can reduce the patulin content of the apple juice.IC50 value:Target:In vitro: In human dermal fibroblasts from three different donors, D-Pantothenic acid hemicalcium salt accelerates the wound healing process by increasing the number of migrating cells, their distance and hence their speed. In addition, cell division is increased and the protein synthesis changed [1].In vivo: |
| Density | 1.266g/cm3 |
| Boiling Point | 551.5ºC at 760 mmHg |
| Flash Point | 145 °C |
| PSA | 191.72000 |