Home
Products
(-)-Syringaresinol 4-(2''-apiosylglucoside)
| Product Name | (-)-Syringaresinol 4-(2''-apiosylglucoside) |
| Price: | $77 / 20mg |
| Catalog No.: | CN02989 |
| CAS No.: | 136997-64-3 |
| Molecular Formula: | C33H44O17 |
| Molecular Weight: | 712.69 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | Albizia julibrissin Duraz. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(OC)cc(cc2OC)[C@@H]2OC[C@@H]3[C@H]2CO[C@H]3c2cc(OC)c(c(c2)OC)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1OC[C@]([C@H]1O)(O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Syringaresnol-4-O-β-D-apiofuranosyl-(1→2)-β-D-glucopyranoside is isolated from the bark of Albizzia myriophylla[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 935.3±65.0 °C at 760 mmHg |
| Flash Point | 519.5±34.3 °C |
| Exact Mass | 712.257874 |
| PSA | 233.91000 |
| LogP | -0.25 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2~8℃ |