Home
Products
Anemarsaponin E
| Product Name | Anemarsaponin E |
| Price: | Inquiry |
| Catalog No.: | CN02586 |
| CAS No.: | 136565-73-6 |
| Molecular Formula: | C46H78O19 |
| Molecular Weight: | 934.03 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Anemarrhena asphodeloides Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]2[C@@H]3CC[C@]3([C@H]2C[C@H]2[C@@H]3[C@H](C)[C@@](O2)(OC)CC[C@@H](CO[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Anemarsaponin E is extracted from Anemarrhena asphodeloides Bunge and has anti-inflammatory activity. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1016.6±65.0 °C at 760 mmHg |
| Flash Point | 568.6±34.3 °C |
| Exact Mass | 934.513733 |
| PSA | 296.37000 |
| LogP | 0.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |