Home
Products
Isoastragaloside IV
| Product Name | Isoastragaloside IV |
| Price: | Inquiry |
| Catalog No.: | CN07280 |
| CAS No.: | 136033-55-1 |
| Molecular Formula: | C41H68O14 |
| Molecular Weight: | 784.98 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Astragalus membranaceus (Fisch.) Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC([C@@H]2CC[C@](O2)(C)[C@H]2[C@@H](O)C[C@@]3([C@]2(C)CC[C@@]24[C@H]3C[C@@H]([C@@H]3[C@]4(C2)CC[C@@H](C3(C)C)O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)O)C)(C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoastragaloside IV is a triterpene oligoglycoside isolated from Astragali Radix. |
| Storage condition | 2-8°C |