Home
Products
Ranaconitine
| Product Name | Ranaconitine |
| Price: | Inquiry |
| Catalog No.: | CN01026 |
| CAS No.: | 1360-76-5 |
| Molecular Formula: | C32H44N2O9 |
| Molecular Weight: | 600.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum sinomontanum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCN1C[C@@]2(CC[C@@H]([C@]34C1[C@](O)(C[C@H]23)[C@@]1([C@@]2([C@H]4C[C@@H]([C@@H]2OC)[C@H](C1)OC)O)O)OC)OC(=O)c1ccccc1NC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ranaconitine is a diterpene alkaloid isolated from A. leucostomum, with cardiotoxicity[1]. |
| Density | 1.39g/cm3 |
| Boiling Point | 758.9ºC at 760mmHg |
| Flash Point | 412.8ºC |
| Exact Mass | 600.30500 |
| PSA | 150.51000 |
| LogP | 1.92390 |
| Vapour Pressure | 0mmHg at 25°C |
| Storage condition | -20℃ |