Home
Products
Isoforsythiaside
| Product Name | Isoforsythiaside |
| Price: | $204 / 10mg |
| Catalog No.: | CN06954 |
| CAS No.: | 1357910-26-9 |
| Molecular Formula: | C29H36O15 |
| Molecular Weight: | 624.59 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Forsythia suspensa. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(OC1C(O)C(OCCc2ccc(c(c2)O)O)OC(C1O)COC1OC(C)C(C(C1O)O)O)C=Cc1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoforsythiaside, isolated from Forsythia suspensa, is an antioxidant and antibacterial phenylethanoid glycoside with MICs of 40.83, 40.83, and 81.66 μg/mL for Escherichia coli(E. coli), Pseudomonas aeruginosa(PAO), and Staphylococcus aureus (SA), respectively[1]. |
| In Vitro | Isoforsythiaside is a glycoside isomer of Forsythiaside[1]。 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 926.2±65.0 °C at 760 mmHg |
| Flash Point | 300.6±27.8 °C |
| Exact Mass | 624.205444 |
| PSA | 245.29000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |