Home
Products
(+)-Isocorydine hydrochloride
| Product Name | (+)-Isocorydine hydrochloride |
| Price: | Inquiry |
| Catalog No.: | CN00615 |
| CAS No.: | 13552-72-2 |
| Molecular Formula: | C20H24ClNO4 |
| Molecular Weight: | 377.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Corydalis yanhusuo |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1O)c1c(OC)c(OC)cc3c1[C@H](C2)N(C)CC3.Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.222 g/cm3 |
| Boiling Point | 506.1ºC at 760 mmHg |
| Flash Point | 259.9ºC |
| Exact Mass | 377.13900 |
| PSA | 51.16000 |
| LogP | 3.91000 |
| Storage condition | -20°C |