Home
Products
Bullatine A
| Product Name | Bullatine A |
| Price: | Inquiry |
| Catalog No.: | CN01391 |
| CAS No.: | 1354-84-3 |
| Molecular Formula: | C22H33NO2 |
| Molecular Weight: | 343.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum brachypodum Diels |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCN1CC2(C)CCCC34C1C(CC23)C12C4C(O)C(CC1)C(=C)C2O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bullatine A (BLA), a diterpenoid alkaloid of the genus Aconitum, possesses anti-rheumatic, anti-inflammatory and anti-nociceptive effects. Bullatine A (BLA) is a potent P2X7 antagonist, inhibits ATP-induced cell death/apoptosis and P2X receptor-mediated inflammatory responses[1].Bullatine A attenuates pain hypersensitivity, regardless of the pain models employed[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 488.2±45.0 °C at 760 mmHg |
| Flash Point | 242.3±27.4 °C |
| Exact Mass | 343.251129 |
| PSA | 43.70000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |