Home
Products
2''-O-Rhamnosylicariside II
| Product Name | 2''-O-Rhamnosylicariside II |
| Price: | $351 / 5mg |
| Catalog No.: | CN05022 |
| CAS No.: | 135293-13-9 |
| Molecular Formula: | C33H40O14 |
| Molecular Weight: | 660.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Epimedium brevicornu |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(cc1)c1oc2c(CC=C(C)C)c(O)cc(c2c(=O)c1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2''-O-Rhamnosylicariside II is a flavonoid glycoside compound and might be beneficial for improving postmenopausal osteoporosis. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 892.8±65.0 °C at 760 mmHg |
| Flash Point | 283.2±27.8 °C |
| Exact Mass | 660.241821 |
| PSA | 217.97000 |
| LogP | 5.36 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |