Home
Products
6''-O-Acetylglycitin
| Product Name | 6''-O-Acetylglycitin |
| Price: | $366 / 5mg |
| Catalog No.: | CN04838 |
| CAS No.: | 134859-96-4 |
| Molecular Formula: | C24H24O11 |
| Molecular Weight: | 488.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc2c(cc1O[C@@H]1O[C@H](COC(=O)C)[C@H]([C@@H]([C@H]1O)O)O)occ(c2=O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 6''-O-Acetylglycitin, a acetyl glucoside, is one of the isoflavone isomer in soybeans, shows various extents of content reduction dependent on storage temperature, packaging condition, and its isoflavone isomer kind[1]. |
| Density | 1.49g/cm3 |
| Boiling Point | 741.551ºC at 760 mmHg |
| Flash Point | 254.511ºC |
| Exact Mass | 488.13200 |
| PSA | 165.12000 |
| LogP | 0.92370 |
| Vapour Pressure | 0mmHg at 25°C |