Home
Products
Linderane
| Product Name | Linderane |
| Price: | $85 / 20mg |
| Catalog No.: | CN09453 |
| CAS No.: | 13476-25-0 |
| Molecular Formula: | C15H16O4 |
| Molecular Weight: | 260.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Lindera aggregata( Sims) Kosterm |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C/1=C/CC[C@@]23O[C@@H]3[C@H](c3c(C1)occ3C)OC2=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Linderane, isolated from the root of Lindera strychnifolia, is an irreversible inhibitor cytochrome P450 2C9 (CYP2C9). Linderane has the potential to relieve pain and cramp[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 434.5±45.0 °C at 760 mmHg |
| Flash Point | 216.6±28.7 °C |
| Exact Mass | 260.104858 |
| PSA | 51.97000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Storage condition | 2~8°C |