Home
Products
Eriocitrin
| Product Name | Eriocitrin |
| Price: | $100 / 20mg |
| Catalog No.: | CN05506 |
| CAS No.: | 13463-28-0 |
| Molecular Formula: | C27H32O15 |
| Molecular Weight: | 596.53 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Citrus sinensis (L.) Osbeck |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H](O)[C@H](Oc2cc(O)c3c(c2)O[C@@H](CC3=O)c2ccc(c(c2)O)O)O[C@@H]([C@H]1O)CO[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eriocitrin is a flavonoid isolated from lemon, which is a strong antioxidant agent. Eriocitrin could inhibit the proliferation of hepatocellular carcinoma cell lines by arresting cell cycle in S phase through up-regulation of p53, cyclin A, cyclin D3 and CDK6. Eriocitrin triggers apoptosis by activating mitochondria-involved intrinsic signaling pathway[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 956.9±65.0 °C at 760 mmHg |
| Flash Point | 317.0±27.8 °C |
| Exact Mass | 596.174133 |
| PSA | 245.29000 |
| LogP | 1.47 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |