Home
Products
Dehydroandrographolide
| Product Name | Dehydroandrographolide |
| Price: | $18 / 20mg |
| Catalog No.: | CN08893 |
| CAS No.: | 134418-28-3 |
| Molecular Formula: | C20H28O4 |
| Molecular Weight: | 332.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | White powder |
| Source: | The herbs of Andrographis paniculata (Burm. f.) Nees |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@]1(C)[C@H](O)CC[C@@]2([C@@H]1CCC(=C)[C@@H]2C/C=C/1C=COC1=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydroandrographolide is extracted from herbal medicine Andrographis paniculata (Burm f) Nees; alleviate oxidative stress in LPS-induced acute lung injury possibly by inactivating iNOS. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 512.8±50.0 °C at 760 mmHg |
| Flash Point | 178.3±23.6 °C |
| PSA | 86.99000 |
| LogP | 2.97 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |