Home
Products
Epoxymicheliolide
| Product Name | Epoxymicheliolide |
| Price: | Inquiry |
| Catalog No.: | CN09045 |
| CAS No.: | 1343403-10-0 |
| Molecular Formula: | C15H20O4 |
| Molecular Weight: | 264.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Inula helenium L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1C(=O)O[C@H]2[C@H]1CC[C@]1([C@@]3([C@@H]2[C@](C)(O)CC3)O1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epoxymicheliolide is a micheliolide derivative. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 451.6±45.0 °C at 760 mmHg |
| Flash Point | 171.3±22.2 °C |
| Exact Mass | 264.136169 |
| PSA | 59.06000 |
| LogP | 0.54 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Storage condition | 2-8℃ |