Home
Products
beta-Glucogallin
| Product Name | beta-Glucogallin |
| Price: | $293 / 5mg |
| Catalog No.: | CN03341 |
| CAS No.: | 13405-60-2 |
| Molecular Formula: | C13H16O10 |
| Molecular Weight: | 332.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The leaves of Camellia sinensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)c2cc(O)c(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.85 |
| Exact Mass | 332.07400 |
| PSA | 177.14000 |
| Vapour Pressure | 9.04E-23mmHg at 25°C |