Home
Products
Lobeline hydrochloride
| Product Name | Lobeline hydrochloride |
| Price: | Inquiry |
| Catalog No.: | CN00617 |
| CAS No.: | 134-63-4 |
| Molecular Formula: | C22H28ClNO2 |
| Molecular Weight: | 373.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lobelia sessilifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(c1ccccc1)CC1CCCC(N1C)CC(=O)c1ccccc1.Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lobeline hydrochloride, a nicotinic receptor agonist, acting as a potent antagonist at both α3β2 and α4β2 neuronal nicotinic receptor subtypes. |
| Boiling Point | 485.6ºC at 760mmHg |
| Flash Point | 247.5ºC |
| Exact Mass | 373.180847 |
| PSA | 40.54000 |
| LogP | 4.97590 |
| Vapour Pressure | 3.02E-11mmHg at 25°C |
| Storage condition | Store at RT |