Home
Products
Pelargonidin chloride
| Product Name | Pelargonidin chloride |
| Price: | Inquiry |
| Catalog No.: | CN05109 |
| CAS No.: | 134-04-3 |
| Molecular Formula: | C15H11O5Cl |
| Molecular Weight: | 306.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc(cc1)c1[o+]c2cc(O)cc(c2cc1O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pelargonidin chloride is a scavenger of nitric oxide radical and has antioxidant activities[1]. |
| Exact Mass | 306.029510 |
| PSA | 94.06000 |
| LogP | 0.20730 |
| Storage condition | 2-8°C |