Home
Products
Peonidin chloride
| Product Name | Peonidin chloride |
| Price: | Inquiry |
| Catalog No.: | CN05137 |
| CAS No.: | 134-01-0 |
| Molecular Formula: | C16H13ClO6 |
| Molecular Weight: | 336.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(ccc1O)c1[o+]c2cc(O)cc(c2cc1O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Peonidin chloride is an O-methylated anthocyanidin that functions as a primary plant pigment, endowing purplish-red hues to flowers such as the peony, from which it takes its name, as well as berries and vegetables. Peonidin chloride exhibits chemopreventive, as well as anti-inflammatory activities on cancer cells in vitro, blocking COX-2 expression and transformation in JB6 P+ mouse epidermal cells. |
| Target | COX-2 |
| Exact Mass | 336.04000 |
| PSA | 103.29000 |
| LogP | 0.21590 |
| Storage condition | -20C |