Home
Products
3'-Geranyl-3-prenyl-2',4',5,7-tetrahydroxyflavone
| Product Name | 3'-Geranyl-3-prenyl-2',4',5,7-tetrahydroxyflavone |
| Price: | $409 / 5mg |
| Catalog No.: | CN04971 |
| CAS No.: | 1334309-44-2 |
| Molecular Formula: | C30H34O6 |
| Molecular Weight: | 490.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The root barks of Morus alba |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CCc1c(O)ccc(c1O)c1oc2cc(O)cc(c2c(=O)c1CC=C(C)C)O)/CCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3'-Geranyl-3-prenyl-2',4',5,7-tetrahydroxyflavone displays cytotoxicity of 1.32, 3.92 and 5.22 μm against the human cervical carcinoma HeLa, human breast carcinoma MCF-7, and human hepatocarcinoma Hep3B cells[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 708.4±60.0 °C at 760 mmHg |
| Flash Point | 231.2±26.4 °C |
| Exact Mass | 490.235535 |
| PSA | 111.13000 |
| LogP | 7.81 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |