Home
Products
(-)-Asarinin
| Product Name | (-)-Asarinin |
| Price: | Inquiry |
| Catalog No.: | CN02903 |
| CAS No.: | 133-04-0 |
| Molecular Formula: | C20H18O6 |
| Molecular Weight: | 354.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Asarum sieboldii Miq. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C1Oc2c(O1)cc(cc2)[C@@H]1OC[C@@H]2[C@H]1CO[C@@H]2c1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Asarinin is a extract lignan from Zanthoxylum armatum, mainly produced in roots of this herb[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 504.4±50.0 °C at 760 mmHg |
| Flash Point | 212.3±30.0 °C |
| Exact Mass | 354.110352 |
| PSA | 55.38000 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8C |