Home
Products
Neoeriocitrin
| Product Name | Neoeriocitrin |
| Price: | $190 / 10mg |
| Catalog No.: | CN05069 |
| CAS No.: | 13241-32-2 |
| Molecular Formula: | C27H32O15 |
| Molecular Weight: | 596.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Citrus sinensis (L.) Osbeck |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)O[C@@H](CC3=O)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neoeriocitrin, isolated from Drynaria Rhizome, shows activity on proliferation and osteogenic differentiation in MC3T3-E1. Neoeriocitrin is a potent acetylcholinesterase (AChE) inhibitor[1][2]. |
| Density | 1.73g/cm3 |
| Boiling Point | 960.7ºC at 760 mmHg |
| Flash Point | 318.3ºC |
| Exact Mass | 596.17400 |
| PSA | 245.29000 |
| Vapour Pressure | 0mmHg at 25°C |