Home
Products
Chrysophanol 8-O-glucoside
| Product Name | Chrysophanol 8-O-glucoside |
| Price: | $234 / 10mg |
| Catalog No.: | CN06006 |
| CAS No.: | 13241-28-6 |
| Molecular Formula: | C21H20O9 |
| Molecular Weight: | 416.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Rheum emodi. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cccc3c2C(=O)c2c(C3=O)cc(cc2O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chrysophanol 8-O-glucoside, from the roots of Rumex acetosa, shows moderate elastase inhibition activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 763.2±60.0 °C at 760 mmHg |
| Flash Point | 272.8±26.4 °C |
| Exact Mass | 416.110718 |
| PSA | 153.75000 |
| LogP | 1.55 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Storage condition | 2-8°C |