Home
Products
5-Acetoxy-7-hydroxyflavone
| Product Name | 5-Acetoxy-7-hydroxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN05558 |
| CAS No.: | 132351-58-7 |
| Molecular Formula: | C17H12O5 |
| Molecular Weight: | 296.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The heartwoods of Pinus armandii. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1cc(O)cc2c1c(=O)cc(o2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 534.9±50.0 °C at 760 mmHg |
| Flash Point | 202.4±23.6 °C |
| Exact Mass | 296.068481 |
| PSA | 76.74000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |