Home
Products
Tryptanthrine
| Product Name | Tryptanthrine |
| Price: | Inquiry |
| Catalog No.: | CN00693 |
| CAS No.: | 13220-57-0 |
| Molecular Formula: | C15H8N2O2 |
| Molecular Weight: | 248.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The leaves of Strobilanthes cusia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1c2nc3ccccc3c(=O)n2c2c1cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tryptanthrin is a potent and orally active cellular Leukotriene (LT) biosynthesis inhibitor. Tryptanthrin inhibits LT formation in human whole blood (IC50 = 10 µM) and reduces LTB4 levels in the rat pleurisy model[1]. |
| Target | IC50: 10 µM (LT formation in human whole blood)[1] |
| Density | 1.45g/cm3 |
| Boiling Point | 469.3ºC at 760 mmHg |
| Flash Point | 237.7ºC |
| Exact Mass | 248.05900 |
| PSA | 51.96000 |
| LogP | 1.93010 |
| Vapour Pressure | 5.55E-09mmHg at 25°C |