Home
Products
Dihydrocucurbitacin B
| Product Name | Dihydrocucurbitacin B |
| Price: | $467 / 5mg |
| Catalog No.: | CN07714 |
| CAS No.: | 13201-14-4 |
| Molecular Formula: | C32H48O8 |
| Molecular Weight: | 560.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Hemsleya amabilis Diels. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC(CCC(=O)[C@@]([C@H]1[C@H](O)C[C@@]2([C@]1(C)CC(=O)[C@@]1([C@H]2CC=C2[C@H]1C[C@H](O)C(=O)C2(C)C)C)C)(O)C)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dihydrocucurbitacin B, a triterpene isolated from Cayaponia tayuya roots, inhibits nuclear factor of activated T cells (NFAT), induces cell cycle arrested in the G0 phase, and inhibits delayed type hypersensitivity[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 692.2±55.0 °C at 760 mmHg |
| Flash Point | 215.4±25.0 °C |
| Exact Mass | 560.334900 |
| PSA | 138.20000 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |
| Storage condition | 2-8℃ |