Home
Products
(+)-Pteryxin
| Product Name | (+)-Pteryxin |
| Price: | $176 / 20mg |
| Catalog No.: | CN06182 |
| CAS No.: | 13161-75-6 |
| Molecular Formula: | C21H22O7 |
| Molecular Weight: | 386.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Peucedanum harry-smithii var. subglabrum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(C(=O)O[C@@H]1c2c(ccc3c2oc(=O)cc3)OC([C@@H]1OC(=O)C)(C)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pteryxin, a coumarin in Peucedanum japonicum Thunb leaves, exerts antiobesity activity[1]. Pteryxin is a potent butyrylcholinesterase (BChE) inhibitor, with an IC50 of 12.96 μg/ml[2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 486.8±45.0 °C at 760 mmHg |
| Flash Point | 211.5±28.8 °C |
| Exact Mass | 386.136566 |
| PSA | 92.04000 |
| LogP | 4.30 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8℃ |