Home
Products
Nystose
| Product Name | Nystose |
| Price: | $46 / 20mg |
| Catalog No.: | CN06688 |
| CAS No.: | 13133-07-8 |
| Molecular Formula: | C24H42O21 |
| Molecular Weight: | 666.58 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The roots of Morinda officinalis How. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@]([C@H]([C@@H]1O)O)(OC[C@@]1(O[C@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O[C@@H]([C@H]([C@@H]1O)O)CO)CO[C@]1(CO)O[C@@H]([C@H]([C@@H]1O)O)CO |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nystose is a tetrasaccharide with two fructose molecules linked via beta (1→2) bonds to the fructosyl moiety of sucrose. |
| Density | 1.84±0.1 g/cm3 |
| Boiling Point | 1075.7±65.0 °C at 760 mmHg |
| Flash Point | 604.3±34.3 °C |
| Exact Mass | 666.221863 |
| PSA | 347.83000 |
| LogP | -1.76 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8°C |