Home
Products
N1,N5,N10-(Z)-tri-p-coumaroylspermidine
| Product Name | N1,N5,N10-(Z)-tri-p-coumaroylspermidine |
| Price: | $467 / 10mg |
| Catalog No.: | CN00124 |
| CAS No.: | 131086-78-7 |
| Molecular Formula: | C34H37N3O6 |
| Molecular Weight: | 583.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Oil |
| Source: | The herbs of Helianthus annuus L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(/C=C/c1ccc(cc1)O)NCCCCN(C(=O)/C=C/c1ccc(cc1)O)CCCNC(=O)/C=C/c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 954.2±65.0 °C at 760 mmHg |
| Flash Point | 530.9±34.3 °C |
| Exact Mass | 583.268250 |
| LogP | 3.75 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |